C18H17N3O3 — CID 51266821
1-acetyl-N-(2-carbamoylphenyl)-2,3-dihydroindole-5-carboxamide (PubChem CID 51266821) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 1-acetyl-N-(2-carbamoylphenyl)-2,3-dihydroindole-5-carboxamide.
| Compound Name | 1-acetyl-N-(2-carbamoylphenyl)-2,3-dihydroindole-5-carboxamide |
|---|---|
| PubChem CID | 51266821 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-acetyl-N-(2-carbamoylphenyl)-2,3-dihydroindole-5-carboxamide |
| SMILES | CC(=O)N1CCc2cc(C(=O)Nc3ccccc3C(N)=O)ccc21 |
| InChI | InChI=1S/C18H17N3O3/c1-11(22)21-9-8-12-10-13(6-7-16(12)21)18(24)20-15-5-3-2-4-14(15)17(19)23/h2-7,10H,8-9H2,1H3,(H2,19,23)(H,20,24) |
| InChIKey | FGDNKSURMQYYIT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |