C22H25NO4 — CID 51266896
N-(3,4-dihydro-2H-chromen-3-ylmethyl)-3,4-dimethoxy-5-prop-2-enylbenzamide (PubChem CID 51266896) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-3-ylmethyl)-3,4-dimethoxy-5-prop-2-enylbenzamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-3-ylmethyl)-3,4-dimethoxy-5-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 51266896 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-3-ylmethyl)-3,4-dimethoxy-5-prop-2-enylbenzamide |
| SMILES | C=CCc1cc(C(=O)NCC2COc3ccccc3C2)cc(OC)c1OC |
| InChI | InChI=1S/C22H25NO4/c1-4-7-17-11-18(12-20(25-2)21(17)26-3)22(24)23-13-15-10-16-8-5-6-9-19(16)27-14-15/h4-6,8-9,11-12,15H,1,7,10,13-14H2,2-3H3,(H,23,24) |
| InChIKey | PLZNBEGJFHFRES-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|