C20H21N3O4S — CID 51269492
N-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-methylsulfonylbenzamide (PubChem CID 51269492) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-methylsulfonylbenzamide.
| Compound Name | N-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 51269492 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[(2-methoxyphenyl)-(1-methylimidazol-2-yl)methyl]-4-methylsulfonylbenzamide |
| SMILES | COc1ccccc1C(NC(=O)c1ccc(S(C)(=O)=O)cc1)c1nccn1C |
| InChI | InChI=1S/C20H21N3O4S/c1-23-13-12-21-19(23)18(16-6-4-5-7-17(16)27-2)22-20(24)14-8-10-15(11-9-14)28(3,25)26/h4-13,18H,1-3H3,(H,22,24) |
| InChIKey | NRNBGYKSFHCPDN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |