C17H16F3NO2 — CID 51272108
N-[(2-methoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 51272108) has the molecular formula C17H16F3NO2 and a molecular weight of 323.31 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 51272108 |
| Molecular Formula | C17H16F3NO2 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccccc1CNC(=O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H16F3NO2/c1-23-15-5-3-2-4-13(15)11-21-16(22)10-12-6-8-14(9-7-12)17(18,19)20/h2-9H,10-11H2,1H3,(H,21,22) |
| InChIKey | SGXJRVYOIHKUDQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |