C15H14BrNO2 — CID 51273024
5-bromo-N-(1-phenylcyclobutyl)furan-2-carboxamide (PubChem CID 51273024) has the molecular formula C15H14BrNO2 and a molecular weight of 320.19 g/mol. Its IUPAC name is 5-bromo-N-(1-phenylcyclobutyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(1-phenylcyclobutyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 51273024 |
| Molecular Formula | C15H14BrNO2 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 5-bromo-N-(1-phenylcyclobutyl)furan-2-carboxamide |
| SMILES | O=C(NC1(c2ccccc2)CCC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H14BrNO2/c16-13-8-7-12(19-13)14(18)17-15(9-4-10-15)11-5-2-1-3-6-11/h1-3,5-8H,4,9-10H2,(H,17,18) |
| InChIKey | XJTUPZFCRBBRGF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |