About 3-fluorodibenzofuran
3-fluorodibenzofuran (PubChem CID 5127426) has the molecular formula C12H7FO
and a molecular weight of 186.18 g/mol. Its IUPAC name is 3-fluorodibenzofuran.
Molecular Properties
| Compound Name | 3-fluorodibenzofuran |
| PubChem CID | 5127426 |
| Molecular Formula | C12H7FO |
| Molecular Weight | 186.18 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-fluorodibenzofuran |
| SMILES | Fc1ccc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C12H7FO/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7H |
| InChIKey | CBVHWGKANITCQP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.18 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluorodibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluorodibenzofuran?
The IUPAC name of 3-fluorodibenzofuran (CID 5127426) is 3-fluorodibenzofuran.
What is the SMILES notation for 3-fluorodibenzofuran?
The canonical SMILES for 3-fluorodibenzofuran is Fc1ccc2c(c1)oc1ccccc12.
What is the InChIKey of 3-fluorodibenzofuran?
The InChIKey is CBVHWGKANITCQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7FO/c13-8-5-6-10-9-3-1-2-4-11(9)14-12(10)7-8/h1-7H.
What are the key properties of 3-fluorodibenzofuran?
3-fluorodibenzofuran has a molecular weight of 186.18 g/mol, XLogP of 3.73, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorodibenzofuran is sourced from PubChem (CID 5127426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).