About 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene
2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene (PubChem CID 5127598) has the molecular formula C12H18O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene.
Molecular Properties
| Compound Name | 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene |
| PubChem CID | 5127598 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene |
| SMILES | COC(COc1cc(C)ccc1C)OC |
| InChI | InChI=1S/C12H18O3/c1-9-5-6-10(2)11(7-9)15-8-12(13-3)14-4/h5-7,12H,8H2,1-4H3 |
| InChIKey | MZVRITJAZLFDCG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene?
The IUPAC name of 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene (CID 5127598) is 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene.
What is the SMILES notation for 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene?
The canonical SMILES for 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene is COC(COc1cc(C)ccc1C)OC.
What is the InChIKey of 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene?
The InChIKey is MZVRITJAZLFDCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3/c1-9-5-6-10(2)11(7-9)15-8-12(13-3)14-4/h5-7,12H,8H2,1-4H3.
What are the key properties of 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene?
2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene has a molecular weight of 210.27 g/mol, XLogP of 2.30, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethoxyethoxy)-1,4-dimethylbenzene is sourced from PubChem (CID 5127598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).