C12H16BrNO4 — CID 51279320
3-bromo-N,5-dimethoxy-4-propoxybenzamide (PubChem CID 51279320) has the molecular formula C12H16BrNO4 and a molecular weight of 318.17 g/mol. Its IUPAC name is 3-bromo-N,5-dimethoxy-4-propoxybenzamide.
| Compound Name | 3-bromo-N,5-dimethoxy-4-propoxybenzamide |
|---|---|
| PubChem CID | 51279320 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 3-bromo-N,5-dimethoxy-4-propoxybenzamide |
| SMILES | CCCOc1c(Br)cc(C(=O)NOC)cc1OC |
| InChI | InChI=1S/C12H16BrNO4/c1-4-5-18-11-9(13)6-8(7-10(11)16-2)12(15)14-17-3/h6-7H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | QSGXKTBVEISJTF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|