C13H22N8S2 — CID 51280065
2-N,2-N-dimethyl-6-[1-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 51280065) has the molecular formula C13H22N8S2 and a molecular weight of 354.51 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-[1-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-[1-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 51280065 |
| Molecular Formula | C13H22N8S2 |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-N,2-N-dimethyl-6-[1-[[5-(2-methylpropylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)CNc1nnc(SC(C)c2nc(N)nc(N(C)C)n2)s1 |
| InChI | InChI=1S/C13H22N8S2/c1-7(2)6-15-12-19-20-13(23-12)22-8(3)9-16-10(14)18-11(17-9)21(4)5/h7-8H,6H2,1-5H3,(H,15,19)(H2,14,16,17,18) |
| InChIKey | GCLQWZIBDNRHGV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |