C12H13N3O3S — CID 51280170
3-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-d]pyrimidin-4-one (PubChem CID 51280170) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 3-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 51280170 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 3-(2-morpholin-4-yl-2-oxoethyl)thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=C(Cn1cnc2ccsc2c1=O)N1CCOCC1 |
| InChI | InChI=1S/C12H13N3O3S/c16-10(14-2-4-18-5-3-14)7-15-8-13-9-1-6-19-11(9)12(15)17/h1,6,8H,2-5,7H2 |
| InChIKey | NDFOEBOKEYGQPR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |