C11H12Cl2O2S — CID 5128433
ethyl 2-[(2,4-dichlorophenyl)methylsulfanyl]acetate (PubChem CID 5128433) has the molecular formula C11H12Cl2O2S and a molecular weight of 279.19 g/mol. Its IUPAC name is ethyl 2-[(2,4-dichlorophenyl)methylsulfanyl]acetate.
| Compound Name | ethyl 2-[(2,4-dichlorophenyl)methylsulfanyl]acetate |
|---|---|
| PubChem CID | 5128433 |
| Molecular Formula | C11H12Cl2O2S |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | ethyl 2-[(2,4-dichlorophenyl)methylsulfanyl]acetate |
| SMILES | CCOC(=O)CSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H12Cl2O2S/c1-2-15-11(14)7-16-6-8-3-4-9(12)5-10(8)13/h3-5H,2,6-7H2,1H3 |
| InChIKey | OKAXSBNIUSODCG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |