About 2-propyl-1,3,2-benzodioxaborole
2-propyl-1,3,2-benzodioxaborole (PubChem CID 5128447) has the molecular formula C9H11BO2
and a molecular weight of 162.00 g/mol. Its IUPAC name is 2-propyl-1,3,2-benzodioxaborole.
Molecular Properties
| Compound Name | 2-propyl-1,3,2-benzodioxaborole |
| PubChem CID | 5128447 |
| Molecular Formula | C9H11BO2 |
| Molecular Weight | 162.00 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 2-propyl-1,3,2-benzodioxaborole |
| SMILES | CCCB1Oc2ccccc2O1 |
| InChI | InChI=1S/C9H11BO2/c1-2-7-10-11-8-5-3-4-6-9(8)12-10/h3-6H,2,7H2,1H3 |
| InChIKey | VIKLNEIFCBHZLL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.00 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-propyl-1,3,2-benzodioxaborole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propyl-1,3,2-benzodioxaborole?
The IUPAC name of 2-propyl-1,3,2-benzodioxaborole (CID 5128447) is 2-propyl-1,3,2-benzodioxaborole.
What is the SMILES notation for 2-propyl-1,3,2-benzodioxaborole?
The canonical SMILES for 2-propyl-1,3,2-benzodioxaborole is CCCB1Oc2ccccc2O1.
What is the InChIKey of 2-propyl-1,3,2-benzodioxaborole?
The InChIKey is VIKLNEIFCBHZLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BO2/c1-2-7-10-11-8-5-3-4-6-9(8)12-10/h3-6H,2,7H2,1H3.
What are the key properties of 2-propyl-1,3,2-benzodioxaborole?
2-propyl-1,3,2-benzodioxaborole has a molecular weight of 162.00 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propyl-1,3,2-benzodioxaborole is sourced from PubChem (CID 5128447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).