C18H18F4N2O2 — CID 51284669
N-[1-(4-fluorophenyl)-2-methylpropyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide (PubChem CID 51284669) has the molecular formula C18H18F4N2O2 and a molecular weight of 370.35 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)-2-methylpropyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide.
| Compound Name | N-[1-(4-fluorophenyl)-2-methylpropyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
|---|---|
| PubChem CID | 51284669 |
| Molecular Formula | C18H18F4N2O2 |
| Molecular Weight | 370.35 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | N-[1-(4-fluorophenyl)-2-methylpropyl]-2-[2-oxo-5-(trifluoromethyl)-1-pyridinyl]acetamide |
| SMILES | CC(C)C(NC(=O)Cn1cc(C(F)(F)F)ccc1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18F4N2O2/c1-11(2)17(12-3-6-14(19)7-4-12)23-15(25)10-24-9-13(18(20,21)22)5-8-16(24)26/h3-9,11,17H,10H2,1-2H3,(H,23,25) |
| InChIKey | RRSBJWWOWIJXGR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |