About 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide
2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide (PubChem CID 512848) has the molecular formula C23H42N2O3S
and a molecular weight of 426.67 g/mol. Its IUPAC name is 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide.
Molecular Properties
| Compound Name | 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide |
| PubChem CID | 512848 |
| Molecular Formula | C23H42N2O3S |
| Molecular Weight | 426.67 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide |
| SMILES | CCCCCCCCCN1C(=O)CC(SCCNC(=O)C(CC)CCCC)C1=O |
| InChI | InChI=1S/C23H42N2O3S/c1-4-7-9-10-11-12-13-16-25-21(26)18-20(23(25)28)29-17-15-24-22(27)19(6-3)14-8-5-2/h19-20H,4-18H2,1-3H3,(H,24,27) |
| InChIKey | BNCTYHXYEMEQPV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide?
The IUPAC name of 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide (CID 512848) is 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide.
What is the SMILES notation for 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide?
The canonical SMILES for 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide is CCCCCCCCCN1C(=O)CC(SCCNC(=O)C(CC)CCCC)C1=O.
What is the InChIKey of 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide?
The InChIKey is BNCTYHXYEMEQPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H42N2O3S/c1-4-7-9-10-11-12-13-16-25-21(26)18-20(23(25)28)29-17-15-24-22(27)19(6-3)14-8-5-2/h19-20H,4-18H2,1-3H3,(H,24,27).
What are the key properties of 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide?
2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide has a molecular weight of 426.67 g/mol, XLogP of 4.93, 17 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]hexanamide is sourced from PubChem (CID 512848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).