About N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide
N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide (PubChem CID 512854) has the molecular formula C21H36N2O3S
and a molecular weight of 396.60 g/mol. Its IUPAC name is N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide |
| PubChem CID | 512854 |
| Molecular Formula | C21H36N2O3S |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide |
| SMILES | CCCCCCCCCN1C(=O)CC(SCCNC(=O)C2CCCC2)C1=O |
| InChI | InChI=1S/C21H36N2O3S/c1-2-3-4-5-6-7-10-14-23-19(24)16-18(21(23)26)27-15-13-22-20(25)17-11-8-9-12-17/h17-18H,2-16H2,1H3,(H,22,25) |
| InChIKey | VINRMNUKTXKHED-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide?
The IUPAC name of N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide (CID 512854) is N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide.
What is the SMILES notation for N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide?
The canonical SMILES for N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide is CCCCCCCCCN1C(=O)CC(SCCNC(=O)C2CCCC2)C1=O.
What is the InChIKey of N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide?
The InChIKey is VINRMNUKTXKHED-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H36N2O3S/c1-2-3-4-5-6-7-10-14-23-19(24)16-18(21(23)26)27-15-13-22-20(25)17-11-8-9-12-17/h17-18H,2-16H2,1H3,(H,22,25).
What are the key properties of N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide?
N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide has a molecular weight of 396.60 g/mol, XLogP of 3.90, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(1-nonyl-2,5-dioxopyrrolidin-3-yl)sulfanylethyl]cyclopentanecarboxamide is sourced from PubChem (CID 512854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).