C24H19N3O2 — CID 5128973
3-(1H-benzimidazol-2-yl)-6-methoxy-N-(4-methylphenyl)chromen-2-imine (PubChem CID 5128973) has the molecular formula C24H19N3O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 3-(1H-benzimidazol-2-yl)-6-methoxy-N-(4-methylphenyl)chromen-2-imine.
| Compound Name | 3-(1H-benzimidazol-2-yl)-6-methoxy-N-(4-methylphenyl)chromen-2-imine |
|---|---|
| PubChem CID | 5128973 |
| Molecular Formula | C24H19N3O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 3-(1H-benzimidazol-2-yl)-6-methoxy-N-(4-methylphenyl)chromen-2-imine |
| SMILES | COc1ccc2o/c(=N\c3ccc(C)cc3)c(-c3nc4ccccc4[nH]3)cc2c1 |
| InChI | InChI=1S/C24H19N3O2/c1-15-7-9-17(10-8-15)25-24-19(23-26-20-5-3-4-6-21(20)27-23)14-16-13-18(28-2)11-12-22(16)29-24/h3-14H,1-2H3,(H,26,27)/b25-24- |
| InChIKey | NMIDZQFRTAUOLO-IZHYLOQSSA-N |
| XLogP | 5.53 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |