C9H9N5 — CID 5129187
2-amino-4-(dimethylamino)buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 5129187) has the molecular formula C9H9N5 and a molecular weight of 187.21 g/mol. Its IUPAC name is 2-amino-4-(dimethylamino)buta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | 2-amino-4-(dimethylamino)buta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 5129187 |
| Molecular Formula | C9H9N5 |
| Molecular Weight | 187.21 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | 2-amino-4-(dimethylamino)buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | CN(C)C=C(C#N)C(N)=C(C#N)C#N |
| InChI | InChI=1S/C9H9N5/c1-14(2)6-8(5-12)9(13)7(3-10)4-11/h6H,13H2,1-2H3 |
| InChIKey | RERURPZPVDXIKF-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|