About 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea
1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea (PubChem CID 5129435) has the molecular formula C7H11N5S
and a molecular weight of 197.27 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea.
Molecular Properties
| Compound Name | 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea |
| PubChem CID | 5129435 |
| Molecular Formula | C7H11N5S |
| Molecular Weight | 197.27 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea |
| SMILES | C=C(C)CNC(=S)Nn1cnnc1 |
| InChI | InChI=1S/C7H11N5S/c1-6(2)3-8-7(13)11-12-4-9-10-5-12/h4-5H,1,3H2,2H3,(H2,8,11,13) |
| InChIKey | WYSLCCLAVKIADD-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea?
The IUPAC name of 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea (CID 5129435) is 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea.
What is the SMILES notation for 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea?
The canonical SMILES for 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea is C=C(C)CNC(=S)Nn1cnnc1.
What is the InChIKey of 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea?
The InChIKey is WYSLCCLAVKIADD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N5S/c1-6(2)3-8-7(13)11-12-4-9-10-5-12/h4-5H,1,3H2,2H3,(H2,8,11,13).
What are the key properties of 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea?
1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea has a molecular weight of 197.27 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methylprop-2-enyl)-3-(1,2,4-triazol-4-yl)thiourea is sourced from PubChem (CID 5129435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).