C31H28N4O3 — CID 5129523
4-[4-[3-(1,3-benzodioxol-5-yl)-2,5-diphenyl-3H-1,2,4-triazol-4-yl]phenyl]morpholine (PubChem CID 5129523) has the molecular formula C31H28N4O3 and a molecular weight of 504.59 g/mol. Its IUPAC name is 4-[4-[3-(1,3-benzodioxol-5-yl)-2,5-diphenyl-3H-1,2,4-triazol-4-yl]phenyl]morpholine.
| Compound Name | 4-[4-[3-(1,3-benzodioxol-5-yl)-2,5-diphenyl-3H-1,2,4-triazol-4-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 5129523 |
| Molecular Formula | C31H28N4O3 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 4-[4-[3-(1,3-benzodioxol-5-yl)-2,5-diphenyl-3H-1,2,4-triazol-4-yl]phenyl]morpholine |
| SMILES | c1ccc(C2=NN(c3ccccc3)C(c3ccc4c(c3)OCO4)N2c2ccc(N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C31H28N4O3/c1-3-7-23(8-4-1)30-32-35(27-9-5-2-6-10-27)31(24-11-16-28-29(21-24)38-22-37-28)34(30)26-14-12-25(13-15-26)33-17-19-36-20-18-33/h1-16,21,31H,17-20,22H2 |
| InChIKey | XHJPJCMKAATKSW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 49.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|