C19H20FN3O3 — CID 51299345
N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-4-(2-oxoimidazolidin-1-yl)benzamide (PubChem CID 51299345) has the molecular formula C19H20FN3O3 and a molecular weight of 357.39 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-4-(2-oxoimidazolidin-1-yl)benzamide.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-4-(2-oxoimidazolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 51299345 |
| Molecular Formula | C19H20FN3O3 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-N-methyl-4-(2-oxoimidazolidin-1-yl)benzamide |
| SMILES | COc1ccc(CN(C)C(=O)c2ccc(N3CCNC3=O)cc2)cc1F |
| InChI | InChI=1S/C19H20FN3O3/c1-22(12-13-3-8-17(26-2)16(20)11-13)18(24)14-4-6-15(7-5-14)23-10-9-21-19(23)25/h3-8,11H,9-10,12H2,1-2H3,(H,21,25) |
| InChIKey | GANUWFWJRZZAJB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |