C11H24N2 — CID 51302
N'-Cyclohexyl-N,N-dimethyl-1,3-propanediamine (PubChem CID 51302) has the molecular formula C11H24N2 and a molecular weight of 184.32 g/mol. Its IUPAC name is N-cyclohexyl-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N'-Cyclohexyl-N,N-dimethyl-1,3-propanediamine |
|---|---|
| PubChem CID | 51302 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | N-cyclohexyl-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNC1CCCCC1 |
| InChI | InChI=1S/C11H24N2/c1-13(2)10-6-9-12-11-7-4-3-5-8-11/h11-12H,3-10H2,1-2H3 |
| InChIKey | NLJGWGDUZPHZQK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 15.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | 117 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|