About N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine
N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine (PubChem CID 513036) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine.
Molecular Properties
| Compound Name | N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine |
| PubChem CID | 513036 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine |
| SMILES | CNC1CC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C13H21N/c1-14-12-7-13(12)10-3-8-2-9(5-10)6-11(13)4-8/h8-12,14H,2-7H2,1H3 |
| InChIKey | XXQOTZBRCCQPND-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine?
The IUPAC name of N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine (CID 513036) is N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine.
What is the SMILES notation for N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine?
The canonical SMILES for N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine is CNC1CC12C1CC3CC(C1)CC2C3.
What is the InChIKey of N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine?
The InChIKey is XXQOTZBRCCQPND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-14-12-7-13(12)10-3-8-2-9(5-10)6-11(13)4-8/h8-12,14H,2-7H2,1H3.
What are the key properties of N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine?
N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine has a molecular weight of 191.32 g/mol, XLogP of 2.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylspiro[adamantane-2,2'-cyclopropane]-1'-amine is sourced from PubChem (CID 513036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).