C41H50N2O4 — CID 5130423
1-[4-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]piperazin-1-yl]ethanone (PubChem CID 5130423) has the molecular formula C41H50N2O4 and a molecular weight of 634.86 g/mol. Its IUPAC name is 1-[4-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 5130423 |
| Molecular Formula | C41H50N2O4 |
| Molecular Weight | 634.86 g/mol |
| Exact Mass | 634.38 |
| IUPAC Name | 1-[4-[[5,13-dihydroxy-6,10-dimethyl-17-(2-phenylbenzoyl)-5-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(CC2(O)CCC3C45C=CC6(C=C4C(=O)c4ccccc4-c4ccccc4)CC(O)CCC6(C)C5CCC32C)CC1 |
| InChI | InChI=1S/C41H50N2O4/c1-28(44)43-23-21-42(22-24-43)27-40(47)18-15-35-38(40,3)17-14-34-37(2)16-13-30(45)25-39(37)19-20-41(34,35)33(26-39)36(46)32-12-8-7-11-31(32)29-9-5-4-6-10-29/h4-12,19-20,26,30,34-35,45,47H,13-18,21-25,27H2,1-3H3 |
| InChIKey | BLCFXEMSOVRWBH-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.86 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|