C11H12N2O2S — CID 51305133
N-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]thiophene-2-carboxamide (PubChem CID 51305133) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is N-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 51305133 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | N-[1-oxo-1-(prop-2-ynylamino)propan-2-yl]thiophene-2-carboxamide |
| SMILES | C#CCNC(=O)C(C)NC(=O)c1cccs1 |
| InChI | InChI=1S/C11H12N2O2S/c1-3-6-12-10(14)8(2)13-11(15)9-5-4-7-16-9/h1,4-5,7-8H,6H2,2H3,(H,12,14)(H,13,15) |
| InChIKey | GUEUCBHCWYIRCZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|