C16H22N4O3S — CID 51305225
N-[(1-ethylbenzimidazol-2-yl)methyl]-1-methylsulfonylpyrrolidine-2-carboxamide (PubChem CID 51305225) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is N-[(1-ethylbenzimidazol-2-yl)methyl]-1-methylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 51305225 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[(1-ethylbenzimidazol-2-yl)methyl]-1-methylsulfonylpyrrolidine-2-carboxamide |
| SMILES | CCn1c(CNC(=O)C2CCCN2S(C)(=O)=O)nc2ccccc21 |
| InChI | InChI=1S/C16H22N4O3S/c1-3-19-13-8-5-4-7-12(13)18-15(19)11-17-16(21)14-9-6-10-20(14)24(2,22)23/h4-5,7-8,14H,3,6,9-11H2,1-2H3,(H,17,21) |
| InChIKey | YZQKFUGAIMTZLQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |