C9H15N3O7P+ — CID 513060
[(2R,3S,4S,5R)-5-(4-aminopyrimidin-1-ium-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate (PubChem CID 513060) has the molecular formula C9H15N3O7P+ and a molecular weight of 308.21 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5-(4-aminopyrimidin-1-ium-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate.
| Compound Name | [(2R,3S,4S,5R)-5-(4-aminopyrimidin-1-ium-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 513060 |
| Molecular Formula | C9H15N3O7P+ |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | [(2R,3S,4S,5R)-5-(4-aminopyrimidin-1-ium-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] dihydrogen phosphate |
| SMILES | Nc1cc[n+]([C@@H]2O[C@H](CO)[C@@H](OP(=O)(O)O)[C@@H]2O)cn1 |
| InChI | InChI=1S/C9H14N3O7P/c10-6-1-2-12(4-11-6)9-7(14)8(5(3-13)18-9)19-20(15,16)17/h1-2,4-5,7-10,13-14H,3H2,(H2,15,16,17)/p+1/t5-,7+,8-,9-/m1/s1 |
| InChIKey | VFVMTPSACYRMQK-VCGXYPBASA-O |
| XLogP | -2.32 |
| TPSA | 159.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|