About 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine
7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine (PubChem CID 5130713) has the molecular formula C17H37N3O
and a molecular weight of 299.50 g/mol. Its IUPAC name is 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine.
Molecular Properties
| Compound Name | 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine |
| PubChem CID | 5130713 |
| Molecular Formula | C17H37N3O |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.29 |
| IUPAC Name | 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine |
| SMILES | COC(C)(C)CCCC(C)C(C)NCCN1CCNCC1 |
| InChI | InChI=1S/C17H37N3O/c1-15(7-6-8-17(3,4)21-5)16(2)19-11-14-20-12-9-18-10-13-20/h15-16,18-19H,6-14H2,1-5H3 |
| InChIKey | OHMXNUNOZURJCY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine?
The IUPAC name of 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine (CID 5130713) is 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine.
What is the SMILES notation for 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine?
The canonical SMILES for 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine is COC(C)(C)CCCC(C)C(C)NCCN1CCNCC1.
What is the InChIKey of 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine?
The InChIKey is OHMXNUNOZURJCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H37N3O/c1-15(7-6-8-17(3,4)21-5)16(2)19-11-14-20-12-9-18-10-13-20/h15-16,18-19H,6-14H2,1-5H3.
What are the key properties of 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine?
7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine has a molecular weight of 299.50 g/mol, XLogP of 2.10, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-3,7-dimethyl-N-(2-piperazin-1-ylethyl)octan-2-amine is sourced from PubChem (CID 5130713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).