C20H20FNO3 — CID 513072
5-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(4-fluorophenyl)pentan-1-one (PubChem CID 513072) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is 5-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(4-fluorophenyl)pentan-1-one.
| Compound Name | 5-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(4-fluorophenyl)pentan-1-one |
|---|---|
| PubChem CID | 513072 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 5-[4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]-1-(4-fluorophenyl)pentan-1-one |
| SMILES | O=C(CCCCOc1ccc(C2=NCCO2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FNO3/c21-17-8-4-15(5-9-17)19(23)3-1-2-13-24-18-10-6-16(7-11-18)20-22-12-14-25-20/h4-11H,1-3,12-14H2 |
| InChIKey | IBRKEZWTRQYMAV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|