C13H14BrFN2O2S — CID 51309970
3-[(2-bromo-4-fluorophenyl)methyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione (PubChem CID 51309970) has the molecular formula C13H14BrFN2O2S and a molecular weight of 361.24 g/mol. Its IUPAC name is 3-[(2-bromo-4-fluorophenyl)methyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[(2-bromo-4-fluorophenyl)methyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 51309970 |
| Molecular Formula | C13H14BrFN2O2S |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | 3-[(2-bromo-4-fluorophenyl)methyl]-5-(2-methylsulfanylethyl)imidazolidine-2,4-dione |
| SMILES | CSCCC1NC(=O)N(Cc2ccc(F)cc2Br)C1=O |
| InChI | InChI=1S/C13H14BrFN2O2S/c1-20-5-4-11-12(18)17(13(19)16-11)7-8-2-3-9(15)6-10(8)14/h2-3,6,11H,4-5,7H2,1H3,(H,16,19) |
| InChIKey | DSERUZIUKPBTSL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|