C23H31N3O4S — CID 5131138
ethyl 4-[1-[2-(cyclohexen-1-yl)ethyl]-4-(2-methoxyethylcarbamoyl)-5-methylpyrrol-2-yl]-1,3-thiazole-2-carboxylate (PubChem CID 5131138) has the molecular formula C23H31N3O4S and a molecular weight of 445.59 g/mol. Its IUPAC name is ethyl 4-[1-[2-(cyclohexen-1-yl)ethyl]-4-(2-methoxyethylcarbamoyl)-5-methylpyrrol-2-yl]-1,3-thiazole-2-carboxylate.
| Compound Name | ethyl 4-[1-[2-(cyclohexen-1-yl)ethyl]-4-(2-methoxyethylcarbamoyl)-5-methylpyrrol-2-yl]-1,3-thiazole-2-carboxylate |
|---|---|
| PubChem CID | 5131138 |
| Molecular Formula | C23H31N3O4S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | ethyl 4-[1-[2-(cyclohexen-1-yl)ethyl]-4-(2-methoxyethylcarbamoyl)-5-methylpyrrol-2-yl]-1,3-thiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2cc(C(=O)NCCOC)c(C)n2CCC2=CCCCC2)cs1 |
| InChI | InChI=1S/C23H31N3O4S/c1-4-30-23(28)22-25-19(15-31-22)20-14-18(21(27)24-11-13-29-3)16(2)26(20)12-10-17-8-6-5-7-9-17/h8,14-15H,4-7,9-13H2,1-3H3,(H,24,27) |
| InChIKey | XXZZNXGTUNNBHL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|