C23H27N3O — CID 5131399
4-cyclohexyl-3,5,7-trimethyl-11-(5-methylfuran-2-yl)-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene (PubChem CID 5131399) has the molecular formula C23H27N3O and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-cyclohexyl-3,5,7-trimethyl-11-(5-methylfuran-2-yl)-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene.
| Compound Name | 4-cyclohexyl-3,5,7-trimethyl-11-(5-methylfuran-2-yl)-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene |
|---|---|
| PubChem CID | 5131399 |
| Molecular Formula | C23H27N3O |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.22 |
| IUPAC Name | 4-cyclohexyl-3,5,7-trimethyl-11-(5-methylfuran-2-yl)-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene |
| SMILES | Cc1ccc(-c2cc3c4c(C)n(C5CCCCC5)c(C)c4c(C)nn3c2)o1 |
| InChI | InChI=1S/C23H27N3O/c1-14-10-11-21(27-14)18-12-20-23-17(4)26(19-8-6-5-7-9-19)16(3)22(23)15(2)24-25(20)13-18/h10-13,19H,5-9H2,1-4H3 |
| InChIKey | MMJCLPOWHWQWFG-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 35.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |