C28H27Cl2N3O2 — CID 5131403
11-(3,4-dichlorophenyl)-4-[2-(3,4-dimethoxyphenyl)ethyl]-3,5,7-trimethyl-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene (PubChem CID 5131403) has the molecular formula C28H27Cl2N3O2 and a molecular weight of 508.45 g/mol. Its IUPAC name is 11-(3,4-dichlorophenyl)-4-[2-(3,4-dimethoxyphenyl)ethyl]-3,5,7-trimethyl-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene.
| Compound Name | 11-(3,4-dichlorophenyl)-4-[2-(3,4-dimethoxyphenyl)ethyl]-3,5,7-trimethyl-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene |
|---|---|
| PubChem CID | 5131403 |
| Molecular Formula | C28H27Cl2N3O2 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 507.15 |
| IUPAC Name | 11-(3,4-dichlorophenyl)-4-[2-(3,4-dimethoxyphenyl)ethyl]-3,5,7-trimethyl-4,8,9-triazatricyclo[7.3.0.02,6]dodeca-1(12),2,5,7,10-pentaene |
| SMILES | COc1ccc(CCn2c(C)c3c(C)nn4cc(-c5ccc(Cl)c(Cl)c5)cc4c3c2C)cc1OC |
| InChI | InChI=1S/C28H27Cl2N3O2/c1-16-27-17(2)32(11-10-19-6-9-25(34-4)26(12-19)35-5)18(3)28(27)24-14-21(15-33(24)31-16)20-7-8-22(29)23(30)13-20/h6-9,12-15H,10-11H2,1-5H3 |
| InChIKey | XPEVSCRBRVYCSJ-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 40.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |