C20H19NO4S — CID 51317141
N-[(6-methoxynaphthalen-2-yl)methyl]-3-methylsulfonylbenzamide (PubChem CID 51317141) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is N-[(6-methoxynaphthalen-2-yl)methyl]-3-methylsulfonylbenzamide.
| Compound Name | N-[(6-methoxynaphthalen-2-yl)methyl]-3-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 51317141 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | N-[(6-methoxynaphthalen-2-yl)methyl]-3-methylsulfonylbenzamide |
| SMILES | COc1ccc2cc(CNC(=O)c3cccc(S(C)(=O)=O)c3)ccc2c1 |
| InChI | InChI=1S/C20H19NO4S/c1-25-18-9-8-15-10-14(6-7-16(15)11-18)13-21-20(22)17-4-3-5-19(12-17)26(2,23)24/h3-12H,13H2,1-2H3,(H,21,22) |
| InChIKey | ZTYZCYUYLPKYFK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |