C21H25N5O3 — CID 51318945
1,3-dimethyl-7-[4-oxo-4-(2-phenylpyrrolidin-1-yl)butyl]purine-2,6-dione (PubChem CID 51318945) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 1,3-dimethyl-7-[4-oxo-4-(2-phenylpyrrolidin-1-yl)butyl]purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-[4-oxo-4-(2-phenylpyrrolidin-1-yl)butyl]purine-2,6-dione |
|---|---|
| PubChem CID | 51318945 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 1,3-dimethyl-7-[4-oxo-4-(2-phenylpyrrolidin-1-yl)butyl]purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCCC(=O)N2CCCC2c2ccccc2)n(C)c1=O |
| InChI | InChI=1S/C21H25N5O3/c1-23-19-18(20(28)24(2)21(23)29)25(14-22-19)12-7-11-17(27)26-13-6-10-16(26)15-8-4-3-5-9-15/h3-5,8-9,14,16H,6-7,10-13H2,1-2H3 |
| InChIKey | GZMBBBFFFNTENZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 82.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |