About 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one
3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one (PubChem CID 51319975) has the molecular formula C14H16N4OS
and a molecular weight of 288.38 g/mol. Its IUPAC name is 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one.
Molecular Properties
| Compound Name | 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one |
| PubChem CID | 51319975 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one |
| SMILES | O=C1NCCCCC1Sc1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C14H16N4OS/c19-13-12(8-4-5-9-15-13)20-14-16-10-18(17-14)11-6-2-1-3-7-11/h1-3,6-7,10,12H,4-5,8-9H2,(H,15,19) |
| InChIKey | CPPCAMIMSUUZAL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one?
The IUPAC name of 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one (CID 51319975) is 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one.
What is the SMILES notation for 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one?
The canonical SMILES for 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one is O=C1NCCCCC1Sc1ncn(-c2ccccc2)n1.
What is the InChIKey of 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one?
The InChIKey is CPPCAMIMSUUZAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4OS/c19-13-12(8-4-5-9-15-13)20-14-16-10-18(17-14)11-6-2-1-3-7-11/h1-3,6-7,10,12H,4-5,8-9H2,(H,15,19).
What are the key properties of 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one?
3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one has a molecular weight of 288.38 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-phenyl-1,2,4-triazol-3-yl)sulfanyl]azepan-2-one is sourced from PubChem (CID 51319975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).