C27H29N6O5P — CID 513202
benzyl (2S)-2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 513202) has the molecular formula C27H29N6O5P and a molecular weight of 548.54 g/mol. Its IUPAC name is benzyl (2S)-2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 513202 |
| Molecular Formula | C27H29N6O5P |
| Molecular Weight | 548.54 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | benzyl (2S)-2-[[[(1R,4S)-4-(6-aminopurin-9-yl)cyclopent-2-en-1-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | C[C@H](NP(=O)(OC[C@H]1C=C[C@@H](n2cnc3c(N)ncnc32)C1)Oc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H29N6O5P/c1-19(27(34)36-15-20-8-4-2-5-9-20)32-39(35,38-23-10-6-3-7-11-23)37-16-21-12-13-22(14-21)33-18-31-24-25(28)29-17-30-26(24)33/h2-13,17-19,21-22H,14-16H2,1H3,(H,32,35)(H2,28,29,30)/t19-,21-,22+,39?/m0/s1 |
| InChIKey | ZQTOPXHRKPCGBD-SBFTWIGRSA-N |
| XLogP | 4.45 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|