About [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone
[1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 51321700) has the molecular formula C20H25ClN2O4
and a molecular weight of 392.88 g/mol. Its IUPAC name is [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone.
Molecular Properties
| Compound Name | [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone |
| PubChem CID | 51321700 |
| Molecular Formula | C20H25ClN2O4 |
| Molecular Weight | 392.88 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(C1CCCN(C(=O)C2COc3ccc(Cl)cc3C2)C1)N1CCOCC1 |
| InChI | InChI=1S/C20H25ClN2O4/c21-17-3-4-18-15(11-17)10-16(13-27-18)20(25)23-5-1-2-14(12-23)19(24)22-6-8-26-9-7-22/h3-4,11,14,16H,1-2,5-10,12-13H2 |
| InChIKey | CJBAVIUHYMHVFZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.88 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone?
The IUPAC name of [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone (CID 51321700) is [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone.
What is the SMILES notation for [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone?
The canonical SMILES for [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone is O=C(C1CCCN(C(=O)C2COc3ccc(Cl)cc3C2)C1)N1CCOCC1.
What is the InChIKey of [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone?
The InChIKey is CJBAVIUHYMHVFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25ClN2O4/c21-17-3-4-18-15(11-17)10-16(13-27-18)20(25)23-5-1-2-14(12-23)19(24)22-6-8-26-9-7-22/h3-4,11,14,16H,1-2,5-10,12-13H2.
What are the key properties of [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone?
[1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone has a molecular weight of 392.88 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(6-chloro-3,4-dihydro-2H-chromene-3-carbonyl)piperidin-3-yl]-morpholin-4-ylmethanone is sourced from PubChem (CID 51321700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).