C18H22N4O2S — CID 51323480
2-(4-oxothieno[3,2-d]pyrimidin-3-yl)-N-[(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]acetamide (PubChem CID 51323480) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 2-(4-oxothieno[3,2-d]pyrimidin-3-yl)-N-[(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]acetamide.
| Compound Name | 2-(4-oxothieno[3,2-d]pyrimidin-3-yl)-N-[(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]acetamide |
|---|---|
| PubChem CID | 51323480 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-(4-oxothieno[3,2-d]pyrimidin-3-yl)-N-[(Z)-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)amino]acetamide |
| SMILES | CC12CCC(C/C1=N/NC(=O)Cn1cnc3ccsc3c1=O)C2(C)C |
| InChI | InChI=1S/C18H22N4O2S/c1-17(2)11-4-6-18(17,3)13(8-11)20-21-14(23)9-22-10-19-12-5-7-25-15(12)16(22)24/h5,7,10-11H,4,6,8-9H2,1-3H3,(H,21,23)/b20-13- |
| InChIKey | YHTJEAIPEKUTOI-MOSHPQCFSA-N |
| XLogP | 2.78 |
| TPSA | 76.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|