C25H32FN2O7P — CID 513237
1-[(2R,5S)-5-[(6,8-ditert-butyl-5-fluoro-2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl)oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 513237) has the molecular formula C25H32FN2O7P and a molecular weight of 522.51 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[(6,8-ditert-butyl-5-fluoro-2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl)oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[(6,8-ditert-butyl-5-fluoro-2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl)oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 513237 |
| Molecular Formula | C25H32FN2O7P |
| Molecular Weight | 522.51 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | 1-[(2R,5S)-5-[(6,8-ditert-butyl-5-fluoro-2-oxo-4H-1,3,2lambda5-benzodioxaphosphinin-2-yl)oxymethyl]-2,5-dihydrofuran-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C=C[C@@H](COP3(=O)OCc4c(F)c(C(C)(C)C)cc(C(C)(C)C)c4O3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H32FN2O7P/c1-14-11-28(23(30)27-22(14)29)19-9-8-15(34-19)12-32-36(31)33-13-16-20(26)17(24(2,3)4)10-18(21(16)35-36)25(5,6)7/h8-11,15,19H,12-13H2,1-7H3,(H,27,29,30)/t15-,19+,36?/m0/s1 |
| InChIKey | OFXDQYWUBQYOOZ-HPOUCBOBSA-N |
| XLogP | 4.77 |
| TPSA | 108.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|