C21H27NO3 — CID 51324675
cyclobutyl-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone (PubChem CID 51324675) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is cyclobutyl-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone.
| Compound Name | cyclobutyl-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone |
|---|---|
| PubChem CID | 51324675 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | cyclobutyl-(6-methylspiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-yl)methanone |
| SMILES | CC1c2cc3c(cc2C2(CCCC2)CN1C(=O)C1CCC1)OCCO3 |
| InChI | InChI=1S/C21H27NO3/c1-14-16-11-18-19(25-10-9-24-18)12-17(16)21(7-2-3-8-21)13-22(14)20(23)15-5-4-6-15/h11-12,14-15H,2-10,13H2,1H3 |
| InChIKey | ORQNBVXIAZQXFW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |