C24H20N2O4 — CID 5132495
2-benzylspiro[3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-4,2'-indene]-1,1',3,3'-tetrone (PubChem CID 5132495) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2-benzylspiro[3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-4,2'-indene]-1,1',3,3'-tetrone.
| Compound Name | 2-benzylspiro[3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-4,2'-indene]-1,1',3,3'-tetrone |
|---|---|
| PubChem CID | 5132495 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-benzylspiro[3a,6,7,8,8a,8b-hexahydropyrrolo[3,4-a]pyrrolizine-4,2'-indene]-1,1',3,3'-tetrone |
| SMILES | O=C1C2C3CCCN3C3(C(=O)c4ccccc4C3=O)C2C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C24H20N2O4/c27-20-15-9-4-5-10-16(15)21(28)24(20)19-18(17-11-6-12-26(17)24)22(29)25(23(19)30)13-14-7-2-1-3-8-14/h1-5,7-10,17-19H,6,11-13H2 |
| InChIKey | HEHFOPZHMIPVSA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|