C21H17ClN4O4S — CID 5132537
N-(3-chlorophenyl)-2-[5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide (PubChem CID 5132537) has the molecular formula C21H17ClN4O4S and a molecular weight of 456.91 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 5132537 |
| Molecular Formula | C21H17ClN4O4S |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-(3-chlorophenyl)-2-[5-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetamide |
| SMILES | Cn1c(=O)n(C)c2cc(C=C3SC(=O)N(CC(=O)Nc4cccc(Cl)c4)C3=O)ccc21 |
| InChI | InChI=1S/C21H17ClN4O4S/c1-24-15-7-6-12(8-16(15)25(2)20(24)29)9-17-19(28)26(21(30)31-17)11-18(27)23-14-5-3-4-13(22)10-14/h3-10H,11H2,1-2H3,(H,23,27) |
| InChIKey | SVNXLNJSDZNAOF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|