C26H31N3O — CID 5132779
3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile (PubChem CID 5132779) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 5132779 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(5,6-dimethyl-1H-benzimidazol-2-yl)prop-2-enenitrile |
| SMILES | Cc1cc2nc(C(C#N)=Cc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)[nH]c2cc1C |
| InChI | InChI=1S/C26H31N3O/c1-15-9-21-22(10-16(15)2)29-24(28-21)18(14-27)11-17-12-19(25(3,4)5)23(30)20(13-17)26(6,7)8/h9-13,30H,1-8H3,(H,28,29) |
| InChIKey | IZKGKGIHAWTDSV-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|