C22H25NO2 — CID 51329229
1-(4-benzoylpiperidin-1-yl)-3-(3-methylphenyl)propan-1-one (PubChem CID 51329229) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-(4-benzoylpiperidin-1-yl)-3-(3-methylphenyl)propan-1-one.
| Compound Name | 1-(4-benzoylpiperidin-1-yl)-3-(3-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 51329229 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1-(4-benzoylpiperidin-1-yl)-3-(3-methylphenyl)propan-1-one |
| SMILES | Cc1cccc(CCC(=O)N2CCC(C(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H25NO2/c1-17-6-5-7-18(16-17)10-11-21(24)23-14-12-20(13-15-23)22(25)19-8-3-2-4-9-19/h2-9,16,20H,10-15H2,1H3 |
| InChIKey | QMDYXGHWKYJZQA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |