C9HF11 — CID 5132971
1,2,4,5-tetrafluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)benzene (PubChem CID 5132971) has the molecular formula C9HF11 and a molecular weight of 318.09 g/mol. Its IUPAC name is 1,2,4,5-tetrafluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)benzene.
| Compound Name | 1,2,4,5-tetrafluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)benzene |
|---|---|
| PubChem CID | 5132971 |
| Molecular Formula | C9HF11 |
| Molecular Weight | 318.09 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | 1,2,4,5-tetrafluoro-3-(1,1,2,2,3,3,3-heptafluoropropyl)benzene |
| SMILES | Fc1cc(F)c(F)c(C(F)(F)C(F)(F)C(F)(F)F)c1F |
| InChI | InChI=1S/C9HF11/c10-2-1-3(11)6(13)4(5(2)12)7(14,15)8(16,17)9(18,19)20/h1H |
| InChIKey | RUCXHAOMVXFEPD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.09 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|