C15H20ClN3O4S — CID 51329950
6-chloro-7-(4-propan-2-ylpiperazin-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one (PubChem CID 51329950) has the molecular formula C15H20ClN3O4S and a molecular weight of 373.86 g/mol. Its IUPAC name is 6-chloro-7-(4-propan-2-ylpiperazin-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one.
| Compound Name | 6-chloro-7-(4-propan-2-ylpiperazin-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 51329950 |
| Molecular Formula | C15H20ClN3O4S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 6-chloro-7-(4-propan-2-ylpiperazin-1-yl)sulfonyl-4H-1,4-benzoxazin-3-one |
| SMILES | CC(C)N1CCN(S(=O)(=O)c2cc3c(cc2Cl)NC(=O)CO3)CC1 |
| InChI | InChI=1S/C15H20ClN3O4S/c1-10(2)18-3-5-19(6-4-18)24(21,22)14-8-13-12(7-11(14)16)17-15(20)9-23-13/h7-8,10H,3-6,9H2,1-2H3,(H,17,20) |
| InChIKey | IDLUZVPZOIGZKO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |