C16H23F3N2O3S — CID 51330960
N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 51330960) has the molecular formula C16H23F3N2O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 51330960 |
| Molecular Formula | C16H23F3N2O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | CC1CN(CCCNS(=O)(=O)c2cccc(C(F)(F)F)c2)CC(C)O1 |
| InChI | InChI=1S/C16H23F3N2O3S/c1-12-10-21(11-13(2)24-12)8-4-7-20-25(22,23)15-6-3-5-14(9-15)16(17,18)19/h3,5-6,9,12-13,20H,4,7-8,10-11H2,1-2H3 |
| InChIKey | WATPRZADOBZQRX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|