C18H28N2O4S — CID 51331124
4-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]sulfonyl-2,6-dimethylmorpholine (PubChem CID 51331124) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is 4-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]sulfonyl-2,6-dimethylmorpholine.
| Compound Name | 4-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 51331124 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 4-[2-(4-ethoxyphenyl)pyrrolidin-1-yl]sulfonyl-2,6-dimethylmorpholine |
| SMILES | CCOc1ccc(C2CCCN2S(=O)(=O)N2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C18H28N2O4S/c1-4-23-17-9-7-16(8-10-17)18-6-5-11-20(18)25(21,22)19-12-14(2)24-15(3)13-19/h7-10,14-15,18H,4-6,11-13H2,1-3H3 |
| InChIKey | WGPBPGYMRNMLCO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |