C20H17NO3 — CID 51332390
5-methoxy-3-methyl-N-(3-phenylprop-2-ynyl)-1-benzofuran-2-carboxamide (PubChem CID 51332390) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-methoxy-3-methyl-N-(3-phenylprop-2-ynyl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-methoxy-3-methyl-N-(3-phenylprop-2-ynyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 51332390 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 5-methoxy-3-methyl-N-(3-phenylprop-2-ynyl)-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)NCC#Cc3ccccc3)c(C)c2c1 |
| InChI | InChI=1S/C20H17NO3/c1-14-17-13-16(23-2)10-11-18(17)24-19(14)20(22)21-12-6-9-15-7-4-3-5-8-15/h3-5,7-8,10-11,13H,12H2,1-2H3,(H,21,22) |
| InChIKey | COUOYTACYMHVOL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|