C20H24N2O2S — CID 51332839
2-methyl-N-[4-[[[2-(4-methylphenyl)sulfanylacetyl]amino]methyl]phenyl]propanamide (PubChem CID 51332839) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is 2-methyl-N-[4-[[[2-(4-methylphenyl)sulfanylacetyl]amino]methyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[[[2-(4-methylphenyl)sulfanylacetyl]amino]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 51332839 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 2-methyl-N-[4-[[[2-(4-methylphenyl)sulfanylacetyl]amino]methyl]phenyl]propanamide |
| SMILES | Cc1ccc(SCC(=O)NCc2ccc(NC(=O)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H24N2O2S/c1-14(2)20(24)22-17-8-6-16(7-9-17)12-21-19(23)13-25-18-10-4-15(3)5-11-18/h4-11,14H,12-13H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | HSOXVSVTHKLCNV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |